C39H70NO8P — CID 138306399
[3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-heptadeca-9,12-dienoate (PubChem CID 138306399) has the molecular formula C39H70NO8P and a molecular weight of 711.96 g/mol. Its IUPAC name is [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-heptadeca-9,12-dienoate.
| Compound Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-heptadeca-9,12-dienoate |
|---|---|
| PubChem CID | 138306399 |
| Molecular Formula | C39H70NO8P |
| Molecular Weight | 711.96 g/mol |
| Exact Mass | 711.48 |
| IUPAC Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(9Z,12Z)-heptadeca-9,12-dienoyl]oxypropyl] (9Z,12Z)-heptadeca-9,12-dienoate |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCCCC/C=C\C/C=C\CCCC |
| InChI | InChI=1S/C39H70NO8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-38(41)45-35-37(36-47-49(43,44)46-34-33-40)48-39(42)32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h9-12,15-18,37H,3-8,13-14,19-36,40H2,1-2H3,(H,43,44)/b11-9-,12-10-,17-15-,18-16- |
| InChIKey | YMZSXNDSMIKBOB-DFIVFKFMSA-N |
| XLogP | 10.38 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.96 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|