C28H54O4Si — CID 10906996
(2R)-6-methyl-1-[2-[(Z,5S)-5-tri(propan-2-yl)silyloxyhept-3-enyl]-1,3-dioxan-2-yl]hept-5-en-2-ol (PubChem CID 10906996) has the molecular formula C28H54O4Si and a molecular weight of 482.82 g/mol. Its IUPAC name is (2R)-6-methyl-1-[2-[(Z,5S)-5-tri(propan-2-yl)silyloxyhept-3-enyl]-1,3-dioxan-2-yl]hept-5-en-2-ol.
| Compound Name | (2R)-6-methyl-1-[2-[(Z,5S)-5-tri(propan-2-yl)silyloxyhept-3-enyl]-1,3-dioxan-2-yl]hept-5-en-2-ol |
|---|---|
| PubChem CID | 10906996 |
| Molecular Formula | C28H54O4Si |
| Molecular Weight | 482.82 g/mol |
| Exact Mass | 482.38 |
| IUPAC Name | (2R)-6-methyl-1-[2-[(Z,5S)-5-tri(propan-2-yl)silyloxyhept-3-enyl]-1,3-dioxan-2-yl]hept-5-en-2-ol |
| SMILES | CC[C@@H](/C=C\CCC1(C[C@H](O)CCC=C(C)C)OCCCO1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H54O4Si/c1-10-27(32-33(23(4)5,24(6)7)25(8)9)17-11-12-18-28(30-19-14-20-31-28)21-26(29)16-13-15-22(2)3/h11,15,17,23-27,29H,10,12-14,16,18-21H2,1-9H3/b17-11-/t26-,27+/m1/s1 |
| InChIKey | JDMWIDPXIRJWQY-VSUXQLSVSA-N |
| XLogP | 7.92 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.82 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|