C22H38O2 — CID 118727265
(1R,4E,8E)-5,9,13-trimethyl-1-[(2S)-2-methyloxolan-2-yl]tetradeca-4,8,12-trien-1-ol (PubChem CID 118727265) has the molecular formula C22H38O2 and a molecular weight of 334.54 g/mol. Its IUPAC name is (1R,4E,8E)-5,9,13-trimethyl-1-[(2S)-2-methyloxolan-2-yl]tetradeca-4,8,12-trien-1-ol.
| Compound Name | (1R,4E,8E)-5,9,13-trimethyl-1-[(2S)-2-methyloxolan-2-yl]tetradeca-4,8,12-trien-1-ol |
|---|---|
| PubChem CID | 118727265 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | (1R,4E,8E)-5,9,13-trimethyl-1-[(2S)-2-methyloxolan-2-yl]tetradeca-4,8,12-trien-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@@H](O)[C@]1(C)CCCO1 |
| InChI | InChI=1S/C22H38O2/c1-18(2)10-6-11-19(3)12-7-13-20(4)14-8-15-21(23)22(5)16-9-17-24-22/h10,12,14,21,23H,6-9,11,13,15-17H2,1-5H3/b19-12+,20-14+/t21-,22+/m1/s1 |
| InChIKey | ZAZQYTVKLWKJOE-PGYINGJCSA-N |
| XLogP | 6.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|