C11H22O — CID 3015366
4,8-dimethylnon-7-en-3-ol (PubChem CID 3015366) has the molecular formula C11H22O and a molecular weight of 170.30 g/mol. Its IUPAC name is 4,8-dimethylnon-7-en-3-ol.
| Compound Name | 4,8-dimethylnon-7-en-3-ol |
|---|---|
| PubChem CID | 3015366 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | 4,8-dimethylnon-7-en-3-ol |
| SMILES | CCC(O)C(C)CCC=C(C)C |
| InChI | InChI=1S/C11H22O/c1-5-11(12)10(4)8-6-7-9(2)3/h7,10-12H,5-6,8H2,1-4H3 |
| InChIKey | OLPJEGSRSMHTIA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|