C15H30O — CID 54468843
(3S,4S)-4,7,8,10-tetramethylundec-9-en-3-ol (PubChem CID 54468843) has the molecular formula C15H30O and a molecular weight of 226.40 g/mol. Its IUPAC name is (3S,4S)-4,7,8,10-tetramethylundec-9-en-3-ol.
| Compound Name | (3S,4S)-4,7,8,10-tetramethylundec-9-en-3-ol |
|---|---|
| PubChem CID | 54468843 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | (3S,4S)-4,7,8,10-tetramethylundec-9-en-3-ol |
| SMILES | CC[C@H](O)[C@@H](C)CCC(C)C(C)C=C(C)C |
| InChI | InChI=1S/C15H30O/c1-7-15(16)13(5)9-8-12(4)14(6)10-11(2)3/h10,12-16H,7-9H2,1-6H3/t12?,13-,14?,15-/m0/s1 |
| InChIKey | XGWJVIVCNQQYHZ-SHWKFHJASA-N |
| XLogP | 4.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|