C9H18O — CID 118549067
(2S,3S)-2,3,5-trimethylhex-4-en-1-ol (PubChem CID 118549067) has the molecular formula C9H18O and a molecular weight of 142.24 g/mol. Its IUPAC name is (2S,3S)-2,3,5-trimethylhex-4-en-1-ol.
| Compound Name | (2S,3S)-2,3,5-trimethylhex-4-en-1-ol |
|---|---|
| PubChem CID | 118549067 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | (2S,3S)-2,3,5-trimethylhex-4-en-1-ol |
| SMILES | CC(C)=C[C@H](C)[C@H](C)CO |
| InChI | InChI=1S/C9H18O/c1-7(2)5-8(3)9(4)6-10/h5,8-10H,6H2,1-4H3/t8-,9+/m0/s1 |
| InChIKey | FAESICBYRIKDDI-DTWKUNHWSA-N |
| XLogP | 2.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|