C9H16F2 — CID 143009364
(Z)-1,6-difluoro-2,4,5-trimethylhex-2-ene (PubChem CID 143009364) has the molecular formula C9H16F2 and a molecular weight of 162.22 g/mol. Its IUPAC name is (Z)-1,6-difluoro-2,4,5-trimethylhex-2-ene.
| Compound Name | (Z)-1,6-difluoro-2,4,5-trimethylhex-2-ene |
|---|---|
| PubChem CID | 143009364 |
| Molecular Formula | C9H16F2 |
| Molecular Weight | 162.22 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (Z)-1,6-difluoro-2,4,5-trimethylhex-2-ene |
| SMILES | C/C(=C/C(C)C(C)CF)CF |
| InChI | InChI=1S/C9H16F2/c1-7(5-10)4-8(2)9(3)6-11/h4,8-9H,5-6H2,1-3H3/b7-4- |
| InChIKey | PSNFMBNHWHFITK-DAXSKMNVSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.22 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|