C26H50O8 — CID 158174482
bis((6S)-2,6-dimethyloct-2-ene);(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedioic acid (PubChem CID 158174482) has the molecular formula C26H50O8 and a molecular weight of 490.68 g/mol. Its IUPAC name is bis((6S)-2,6-dimethyloct-2-ene);(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedioic acid.
| Compound Name | bis((6S)-2,6-dimethyloct-2-ene);(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedioic acid |
|---|---|
| PubChem CID | 158174482 |
| Molecular Formula | C26H50O8 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.35 |
| IUPAC Name | bis((6S)-2,6-dimethyloct-2-ene);(2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedioic acid |
| SMILES | CC[C@H](C)CCC=C(C)C.CC[C@H](C)CCC=C(C)C.O=C(O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/2C10H20.C6H10O8/c2*1-5-10(4)8-6-7-9(2)3;7-1(3(9)5(11)12)2(8)4(10)6(13)14/h2*7,10H,5-6,8H2,1-4H3;1-4,7-10H,(H,11,12)(H,13,14)/t2*10-;1-,2+,3+,4-/m00./s1 |
| InChIKey | FXVNOHKUFGDTRS-HEAPWDQQSA-N |
| XLogP | 4.16 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|