C22H38O6 — CID 134992148
bis(2,6-dimethylhept-5-enyl) 2,3-dihydroxybutanedioate (PubChem CID 134992148) has the molecular formula C22H38O6 and a molecular weight of 398.54 g/mol. Its IUPAC name is bis(2,6-dimethylhept-5-enyl) 2,3-dihydroxybutanedioate.
| Compound Name | bis(2,6-dimethylhept-5-enyl) 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 134992148 |
| Molecular Formula | C22H38O6 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | bis(2,6-dimethylhept-5-enyl) 2,3-dihydroxybutanedioate |
| SMILES | CC(C)=CCCC(C)COC(=O)C(O)C(O)C(=O)OCC(C)CCC=C(C)C |
| InChI | InChI=1S/C22H38O6/c1-15(2)9-7-11-17(5)13-27-21(25)19(23)20(24)22(26)28-14-18(6)12-8-10-16(3)4/h9-10,17-20,23-24H,7-8,11-14H2,1-6H3 |
| InChIKey | UFULCEHOIFRDNC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|