C18H32O3 — CID 54045506
ethyl 3-hydroxy-4,8,12-trimethyltrideca-7,11-dienoate (PubChem CID 54045506) has the molecular formula C18H32O3 and a molecular weight of 296.45 g/mol. Its IUPAC name is ethyl 3-hydroxy-4,8,12-trimethyltrideca-7,11-dienoate.
| Compound Name | ethyl 3-hydroxy-4,8,12-trimethyltrideca-7,11-dienoate |
|---|---|
| PubChem CID | 54045506 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | ethyl 3-hydroxy-4,8,12-trimethyltrideca-7,11-dienoate |
| SMILES | CCOC(=O)CC(O)C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C18H32O3/c1-6-21-18(20)13-17(19)16(5)12-8-11-15(4)10-7-9-14(2)3/h9,11,16-17,19H,6-8,10,12-13H2,1-5H3 |
| InChIKey | LPHAYLSEDXIPED-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|