C10H18Cl2 — CID 154099751
7,8-dichloro-2,6-dimethyloct-2-ene (PubChem CID 154099751) has the molecular formula C10H18Cl2 and a molecular weight of 209.16 g/mol. Its IUPAC name is 7,8-dichloro-2,6-dimethyloct-2-ene.
| Compound Name | 7,8-dichloro-2,6-dimethyloct-2-ene |
|---|---|
| PubChem CID | 154099751 |
| Molecular Formula | C10H18Cl2 |
| Molecular Weight | 209.16 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 7,8-dichloro-2,6-dimethyloct-2-ene |
| SMILES | CC(C)=CCCC(C)C(Cl)CCl |
| InChI | InChI=1S/C10H18Cl2/c1-8(2)5-4-6-9(3)10(12)7-11/h5,9-10H,4,6-7H2,1-3H3 |
| InChIKey | DFHIZTRTSRFZPI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.16 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|