C20H38O — CID 129194196
(5R)-5,9-dimethyl-2-[(2R)-6-methylhept-5-en-2-yl]dec-8-en-1-ol (PubChem CID 129194196) has the molecular formula C20H38O and a molecular weight of 294.52 g/mol. Its IUPAC name is (5R)-5,9-dimethyl-2-[(2R)-6-methylhept-5-en-2-yl]dec-8-en-1-ol.
| Compound Name | (5R)-5,9-dimethyl-2-[(2R)-6-methylhept-5-en-2-yl]dec-8-en-1-ol |
|---|---|
| PubChem CID | 129194196 |
| Molecular Formula | C20H38O |
| Molecular Weight | 294.52 g/mol |
| Exact Mass | 294.29 |
| IUPAC Name | (5R)-5,9-dimethyl-2-[(2R)-6-methylhept-5-en-2-yl]dec-8-en-1-ol |
| SMILES | CC(C)=CCC[C@@H](C)CCC(CO)[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C20H38O/c1-16(2)9-7-11-18(5)13-14-20(15-21)19(6)12-8-10-17(3)4/h9-10,18-21H,7-8,11-15H2,1-6H3/t18-,19-,20?/m1/s1 |
| InChIKey | KRWLLHKGGLXETG-LEAGNCFPSA-N |
| XLogP | 6.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.52 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|