C10H19ClO — CID 124706434
(2S,3S)-2-chloro-3,7-dimethyloct-6-en-1-ol (PubChem CID 124706434) has the molecular formula C10H19ClO and a molecular weight of 190.71 g/mol. Its IUPAC name is (2S,3S)-2-chloro-3,7-dimethyloct-6-en-1-ol.
| Compound Name | (2S,3S)-2-chloro-3,7-dimethyloct-6-en-1-ol |
|---|---|
| PubChem CID | 124706434 |
| Molecular Formula | C10H19ClO |
| Molecular Weight | 190.71 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (2S,3S)-2-chloro-3,7-dimethyloct-6-en-1-ol |
| SMILES | CC(C)=CCC[C@H](C)[C@H](Cl)CO |
| InChI | InChI=1S/C10H19ClO/c1-8(2)5-4-6-9(3)10(11)7-12/h5,9-10,12H,4,6-7H2,1-3H3/t9-,10+/m0/s1 |
| InChIKey | VSMFXJDXZRQEHE-VHSXEESVSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.71 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|