C16H31NaO7S — CID 173069796
sodium;1,4-di(hexan-2-yloxy)-1,4-dioxobutane-2-sulfonic acid;hydride (PubChem CID 173069796) has the molecular formula C16H31NaO7S and a molecular weight of 390.47 g/mol. Its IUPAC name is sodium;1,4-di(hexan-2-yloxy)-1,4-dioxobutane-2-sulfonic acid;hydride.
| Compound Name | sodium;1,4-di(hexan-2-yloxy)-1,4-dioxobutane-2-sulfonic acid;hydride |
|---|---|
| PubChem CID | 173069796 |
| Molecular Formula | C16H31NaO7S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | sodium;1,4-di(hexan-2-yloxy)-1,4-dioxobutane-2-sulfonic acid;hydride |
| SMILES | CCCCC(C)OC(=O)CC(C(=O)OC(C)CCCC)S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C16H30O7S.Na.H/c1-5-7-9-12(3)22-15(17)11-14(24(19,20)21)16(18)23-13(4)10-8-6-2;;/h12-14H,5-11H2,1-4H3,(H,19,20,21);;/q;+1;-1 |
| InChIKey | XTOZQQCGTIUOHO-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|