C30H58O9S — CID 122612335
1,4-bis(1-decoxypropoxy)-1,4-dioxobutane-2-sulfonic acid (PubChem CID 122612335) has the molecular formula C30H58O9S and a molecular weight of 594.85 g/mol. Its IUPAC name is 1,4-bis(1-decoxypropoxy)-1,4-dioxobutane-2-sulfonic acid.
| Compound Name | 1,4-bis(1-decoxypropoxy)-1,4-dioxobutane-2-sulfonic acid |
|---|---|
| PubChem CID | 122612335 |
| Molecular Formula | C30H58O9S |
| Molecular Weight | 594.85 g/mol |
| Exact Mass | 594.38 |
| IUPAC Name | 1,4-bis(1-decoxypropoxy)-1,4-dioxobutane-2-sulfonic acid |
| SMILES | CCCCCCCCCCOC(CC)OC(=O)CC(C(=O)OC(CC)OCCCCCCCCCC)S(=O)(=O)O |
| InChI | InChI=1S/C30H58O9S/c1-5-9-11-13-15-17-19-21-23-36-28(7-3)38-27(31)25-26(40(33,34)35)30(32)39-29(8-4)37-24-22-20-18-16-14-12-10-6-2/h26,28-29H,5-25H2,1-4H3,(H,33,34,35) |
| InChIKey | VRWQHNPNFZBHHC-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.85 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|