C28H59IO5Si3 — CID 101166345
[(2S)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] (E,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-iodohex-5-enoate (PubChem CID 101166345) has the molecular formula C28H59IO5Si3 and a molecular weight of 686.94 g/mol. Its IUPAC name is [(2S)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] (E,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-iodohex-5-enoate.
| Compound Name | [(2S)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] (E,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-iodohex-5-enoate |
|---|---|
| PubChem CID | 101166345 |
| Molecular Formula | C28H59IO5Si3 |
| Molecular Weight | 686.94 g/mol |
| Exact Mass | 686.27 |
| IUPAC Name | [(2S)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] (E,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-iodohex-5-enoate |
| SMILES | C[C@@H](CCO[Si](C)(C)C(C)(C)C)OC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H59IO5Si3/c1-22(18-20-31-35(11,12)26(2,3)4)32-25(30)21-24(34-37(15,16)28(8,9)10)23(17-19-29)33-36(13,14)27(5,6)7/h17,19,22-24H,18,20-21H2,1-16H3/b19-17+/t22-,23-,24-/m0/s1 |
| InChIKey | OFSATJYIOKFBEP-DAGNEKNQSA-N |
| XLogP | 9.45 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.94 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|