C18H35IO5Si — CID 24766119
[(2R)-4,4-dimethoxybutan-2-yl] (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-iodohex-5-enoate (PubChem CID 24766119) has the molecular formula C18H35IO5Si and a molecular weight of 486.46 g/mol. Its IUPAC name is [(2R)-4,4-dimethoxybutan-2-yl] (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-iodohex-5-enoate.
| Compound Name | [(2R)-4,4-dimethoxybutan-2-yl] (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-iodohex-5-enoate |
|---|---|
| PubChem CID | 24766119 |
| Molecular Formula | C18H35IO5Si |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | [(2R)-4,4-dimethoxybutan-2-yl] (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-iodohex-5-enoate |
| SMILES | COC(C[C@@H](C)OC(=O)CC[C@@H](/C=C/I)O[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C18H35IO5Si/c1-14(13-17(21-5)22-6)23-16(20)10-9-15(11-12-19)24-25(7,8)18(2,3)4/h11-12,14-15,17H,9-10,13H2,1-8H3/b12-11+/t14-,15+/m1/s1 |
| InChIKey | DSWGPXGWXZFONO-BOXZDTQESA-N |
| XLogP | 5.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|