C27H57IO5Si3 — CID 101166346
3-[tert-butyl(dimethyl)silyl]oxypropyl (E,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-iodohex-5-enoate (PubChem CID 101166346) has the molecular formula C27H57IO5Si3 and a molecular weight of 672.91 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxypropyl (E,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-iodohex-5-enoate.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxypropyl (E,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-iodohex-5-enoate |
|---|---|
| PubChem CID | 101166346 |
| Molecular Formula | C27H57IO5Si3 |
| Molecular Weight | 672.91 g/mol |
| Exact Mass | 672.26 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxypropyl (E,3S,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-iodohex-5-enoate |
| SMILES | CC(C)(C)[Si](C)(C)OCCCOC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H57IO5Si3/c1-25(2,3)34(10,11)31-20-16-19-30-24(29)21-23(33-36(14,15)27(7,8)9)22(17-18-28)32-35(12,13)26(4,5)6/h17-18,22-23H,16,19-21H2,1-15H3/b18-17+/t22-,23-/m0/s1 |
| InChIKey | XWRZDUGABJGQSK-ZRPIXQTESA-N |
| XLogP | 9.06 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.91 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|