C23H48O5Si3 — CID 71583229
2-trimethylsilylethyl (2S,3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydro-2H-pyran-2-carboxylate (PubChem CID 71583229) has the molecular formula C23H48O5Si3 and a molecular weight of 488.89 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2S,3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydro-2H-pyran-2-carboxylate.
| Compound Name | 2-trimethylsilylethyl (2S,3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydro-2H-pyran-2-carboxylate |
|---|---|
| PubChem CID | 71583229 |
| Molecular Formula | C23H48O5Si3 |
| Molecular Weight | 488.89 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 2-trimethylsilylethyl (2S,3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydro-2H-pyran-2-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)OCC[Si](C)(C)C)OC=C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H48O5Si3/c1-22(2,3)30(10,11)27-18-14-15-25-20(21(24)26-16-17-29(7,8)9)19(18)28-31(12,13)23(4,5)6/h14-15,18-20H,16-17H2,1-13H3/t18-,19+,20+/m1/s1 |
| InChIKey | BDVJHVCGTNYHFB-AABGKKOBSA-N |
| XLogP | 6.56 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.89 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|