C24H48O4Si2 — CID 11048757
[(2R)-pent-4-en-2-yl] (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoate (PubChem CID 11048757) has the molecular formula C24H48O4Si2 and a molecular weight of 456.82 g/mol. Its IUPAC name is [(2R)-pent-4-en-2-yl] (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoate.
| Compound Name | [(2R)-pent-4-en-2-yl] (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoate |
|---|---|
| PubChem CID | 11048757 |
| Molecular Formula | C24H48O4Si2 |
| Molecular Weight | 456.82 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | [(2R)-pent-4-en-2-yl] (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoate |
| SMILES | C=CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)O[C@H](C)CC=C |
| InChI | InChI=1S/C24H48O4Si2/c1-14-16-18-20(27-29(10,11)23(4,5)6)21(22(25)26-19(3)17-15-2)28-30(12,13)24(7,8)9/h14-15,19-21H,1-2,16-18H2,3-13H3/t19-,20+,21+/m1/s1 |
| InChIKey | OKWVZIXPKSPVGL-HKBOAZHASA-N |
| XLogP | 7.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.82 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|