C14H28O3Si — CID 141130143
methyl 2-[tert-butyl(dimethyl)silyl]oxyhept-6-enoate (PubChem CID 141130143) has the molecular formula C14H28O3Si and a molecular weight of 272.46 g/mol. Its IUPAC name is methyl 2-[tert-butyl(dimethyl)silyl]oxyhept-6-enoate.
| Compound Name | methyl 2-[tert-butyl(dimethyl)silyl]oxyhept-6-enoate |
|---|---|
| PubChem CID | 141130143 |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | methyl 2-[tert-butyl(dimethyl)silyl]oxyhept-6-enoate |
| SMILES | C=CCCCC(O[Si](C)(C)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C14H28O3Si/c1-8-9-10-11-12(13(15)16-5)17-18(6,7)14(2,3)4/h8,12H,1,9-11H2,2-7H3 |
| InChIKey | VNJJOQURJUMHEH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|