C28H58O4Si2 — CID 10874955
ethyl (Z,2R,3S,4R)-4-methyl-2,3-bis[tri(propan-2-yl)silyloxy]hept-5-enoate (PubChem CID 10874955) has the molecular formula C28H58O4Si2 and a molecular weight of 514.94 g/mol. Its IUPAC name is ethyl (Z,2R,3S,4R)-4-methyl-2,3-bis[tri(propan-2-yl)silyloxy]hept-5-enoate.
| Compound Name | ethyl (Z,2R,3S,4R)-4-methyl-2,3-bis[tri(propan-2-yl)silyloxy]hept-5-enoate |
|---|---|
| PubChem CID | 10874955 |
| Molecular Formula | C28H58O4Si2 |
| Molecular Weight | 514.94 g/mol |
| Exact Mass | 514.39 |
| IUPAC Name | ethyl (Z,2R,3S,4R)-4-methyl-2,3-bis[tri(propan-2-yl)silyloxy]hept-5-enoate |
| SMILES | C/C=C\[C@@H](C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C(=O)OCC |
| InChI | InChI=1S/C28H58O4Si2/c1-16-18-25(15)26(31-33(19(3)4,20(5)6)21(7)8)27(28(29)30-17-2)32-34(22(9)10,23(11)12)24(13)14/h16,18-27H,17H2,1-15H3/b18-16-/t25-,26+,27-/m1/s1 |
| InChIKey | YYUMGCJFUVFYON-PHKLJONKSA-N |
| XLogP | 8.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.94 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|