C24H48O6Si2 — CID 11060028
diethyl (E,4S,5R,6S)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylhept-2-enedioate (PubChem CID 11060028) has the molecular formula C24H48O6Si2 and a molecular weight of 488.81 g/mol. Its IUPAC name is diethyl (E,4S,5R,6S)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylhept-2-enedioate.
| Compound Name | diethyl (E,4S,5R,6S)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylhept-2-enedioate |
|---|---|
| PubChem CID | 11060028 |
| Molecular Formula | C24H48O6Si2 |
| Molecular Weight | 488.81 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | diethyl (E,4S,5R,6S)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylhept-2-enedioate |
| SMILES | CCOC(=O)/C=C/[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C24H48O6Si2/c1-14-27-19(25)17-16-18(3)20(29-31(10,11)23(4,5)6)21(22(26)28-15-2)30-32(12,13)24(7,8)9/h16-18,20-21H,14-15H2,1-13H3/b17-16+/t18-,20+,21-/m0/s1 |
| InChIKey | PZUXXCZVPBDTDR-NGSFFGFOSA-N |
| XLogP | 6.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.81 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|