C23H48O4Si2 — CID 134845345
ethyl (E,4S,5S,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethylhept-2-enoate (PubChem CID 134845345) has the molecular formula C23H48O4Si2 and a molecular weight of 444.81 g/mol. Its IUPAC name is ethyl (E,4S,5S,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethylhept-2-enoate.
| Compound Name | ethyl (E,4S,5S,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethylhept-2-enoate |
|---|---|
| PubChem CID | 134845345 |
| Molecular Formula | C23H48O4Si2 |
| Molecular Weight | 444.81 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | ethyl (E,4S,5S,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6-dimethylhept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H48O4Si2/c1-14-25-20(24)16-15-18(2)21(27-29(12,13)23(7,8)9)19(3)17-26-28(10,11)22(4,5)6/h15-16,18-19,21H,14,17H2,1-13H3/b16-15+/t18-,19-,21-/m0/s1 |
| InChIKey | QCBZEDSQNWSOQP-DXJLAIHTSA-N |
| XLogP | 6.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.81 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|