C28H46O6Si — CID 138975804
[(3S,4E,7S,8R,9E,12R)-12-[(Z)-but-2-en-2-yl]-8-[tert-butyl(dimethyl)silyl]oxy-3,9-dimethyl-2,6-dioxo-1-oxacyclododeca-4,9-dien-7-yl] 3-methylbutanoate (PubChem CID 138975804) has the molecular formula C28H46O6Si and a molecular weight of 506.76 g/mol. Its IUPAC name is [(3S,4E,7S,8R,9E,12R)-12-[(Z)-but-2-en-2-yl]-8-[tert-butyl(dimethyl)silyl]oxy-3,9-dimethyl-2,6-dioxo-1-oxacyclododeca-4,9-dien-7-yl] 3-methylbutanoate.
| Compound Name | [(3S,4E,7S,8R,9E,12R)-12-[(Z)-but-2-en-2-yl]-8-[tert-butyl(dimethyl)silyl]oxy-3,9-dimethyl-2,6-dioxo-1-oxacyclododeca-4,9-dien-7-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 138975804 |
| Molecular Formula | C28H46O6Si |
| Molecular Weight | 506.76 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | [(3S,4E,7S,8R,9E,12R)-12-[(Z)-but-2-en-2-yl]-8-[tert-butyl(dimethyl)silyl]oxy-3,9-dimethyl-2,6-dioxo-1-oxacyclododeca-4,9-dien-7-yl] 3-methylbutanoate |
| SMILES | C/C=C(/C)[C@H]1C/C=C(\C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OC(=O)CC(C)C)C(=O)/C=C/[C@H](C)C(=O)O1 |
| InChI | InChI=1S/C28H46O6Si/c1-12-19(4)23-16-14-20(5)25(34-35(10,11)28(7,8)9)26(33-24(30)17-18(2)3)22(29)15-13-21(6)27(31)32-23/h12-15,18,21,23,25-26H,16-17H2,1-11H3/b15-13+,19-12-,20-14+/t21-,23+,25+,26+/m0/s1 |
| InChIKey | CZRBYWKBLJEMSB-PHGPQDRLSA-N |
| XLogP | 6.32 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.76 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|