C17H32O3Si — CID 10852623
(2R,6R)-6-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-2-propyl-2H-pyran-5-one (PubChem CID 10852623) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is (2R,6R)-6-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-2-propyl-2H-pyran-5-one.
| Compound Name | (2R,6R)-6-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-2-propyl-2H-pyran-5-one |
|---|---|
| PubChem CID | 10852623 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (2R,6R)-6-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-2-propyl-2H-pyran-5-one |
| SMILES | CCC[C@@H]1C=CC(=O)[C@@H](CO[Si](C)(C)C(C)(C)C(C)C)O1 |
| InChI | InChI=1S/C17H32O3Si/c1-8-9-14-10-11-15(18)16(20-14)12-19-21(6,7)17(4,5)13(2)3/h10-11,13-14,16H,8-9,12H2,1-7H3/t14-,16-/m1/s1 |
| InChIKey | WYGJVIKIRUSNEZ-GDBMZVCRSA-N |
| XLogP | 4.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|