C17H30O3Si — CID 23730308
(2R,6S)-6-[(2R)-but-3-en-2-yl]-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2H-pyran-5-one (PubChem CID 23730308) has the molecular formula C17H30O3Si and a molecular weight of 310.51 g/mol. Its IUPAC name is (2R,6S)-6-[(2R)-but-3-en-2-yl]-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2H-pyran-5-one.
| Compound Name | (2R,6S)-6-[(2R)-but-3-en-2-yl]-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2H-pyran-5-one |
|---|---|
| PubChem CID | 23730308 |
| Molecular Formula | C17H30O3Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (2R,6S)-6-[(2R)-but-3-en-2-yl]-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2H-pyran-5-one |
| SMILES | C=C[C@@H](C)[C@@H]1O[C@H](CCO[Si](C)(C)C(C)(C)C)C=CC1=O |
| InChI | InChI=1S/C17H30O3Si/c1-8-13(2)16-15(18)10-9-14(20-16)11-12-19-21(6,7)17(3,4)5/h8-10,13-14,16H,1,11-12H2,2-7H3/t13-,14+,16+/m1/s1 |
| InChIKey | JVGMFKYZIHNRGG-YCPHGPKFSA-N |
| XLogP | 4.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|