C17H29O3Si+ — CID 102411417
(2S)-2-but-3-en-2-yl-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyran-1-ium-3-one (PubChem CID 102411417) has the molecular formula C17H29O3Si+ and a molecular weight of 309.50 g/mol. Its IUPAC name is (2S)-2-but-3-en-2-yl-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyran-1-ium-3-one.
| Compound Name | (2S)-2-but-3-en-2-yl-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyran-1-ium-3-one |
|---|---|
| PubChem CID | 102411417 |
| Molecular Formula | C17H29O3Si+ |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | (2S)-2-but-3-en-2-yl-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]pyran-1-ium-3-one |
| SMILES | C=CC(C)[C@@H]1[O+]=C(CCO[Si](C)(C)C(C)(C)C)C=CC1=O |
| InChI | InChI=1S/C17H29O3Si/c1-8-13(2)16-15(18)10-9-14(20-16)11-12-19-21(6,7)17(3,4)5/h8-10,13,16H,1,11-12H2,2-7H3/q+1/t13?,16-/m0/s1 |
| InChIKey | QQTCDXXFVOQHSD-VYIIXAMBSA-N |
| XLogP | 3.83 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|