C17H30O4Si — CID 23730195
(2S)-2-[(2R)-but-3-en-2-yl]-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-hydroxypyran-3-one (PubChem CID 23730195) has the molecular formula C17H30O4Si and a molecular weight of 326.51 g/mol. Its IUPAC name is (2S)-2-[(2R)-but-3-en-2-yl]-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-hydroxypyran-3-one.
| Compound Name | (2S)-2-[(2R)-but-3-en-2-yl]-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-hydroxypyran-3-one |
|---|---|
| PubChem CID | 23730195 |
| Molecular Formula | C17H30O4Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (2S)-2-[(2R)-but-3-en-2-yl]-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-hydroxypyran-3-one |
| SMILES | C=C[C@@H](C)[C@@H]1OC(O)(CCO[Si](C)(C)C(C)(C)C)C=CC1=O |
| InChI | InChI=1S/C17H30O4Si/c1-8-13(2)15-14(18)9-10-17(19,21-15)11-12-20-22(6,7)16(3,4)5/h8-10,13,15,19H,1,11-12H2,2-7H3/t13-,15+,17?/m1/s1 |
| InChIKey | NLWNNTPMCSJRHB-LYFVRQJISA-N |
| XLogP | 3.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|