C29H56O5Si2 — CID 138979490
(2S)-6-hydroxy-6-methyl-2-[(2S,3R,4R)-4-methyl-3-triethylsilyloxyhex-5-en-2-yl]-5-[tri(propan-2-yl)silyloxymethyl]pyran-3-one (PubChem CID 138979490) has the molecular formula C29H56O5Si2 and a molecular weight of 540.93 g/mol. Its IUPAC name is (2S)-6-hydroxy-6-methyl-2-[(2S,3R,4R)-4-methyl-3-triethylsilyloxyhex-5-en-2-yl]-5-[tri(propan-2-yl)silyloxymethyl]pyran-3-one.
| Compound Name | (2S)-6-hydroxy-6-methyl-2-[(2S,3R,4R)-4-methyl-3-triethylsilyloxyhex-5-en-2-yl]-5-[tri(propan-2-yl)silyloxymethyl]pyran-3-one |
|---|---|
| PubChem CID | 138979490 |
| Molecular Formula | C29H56O5Si2 |
| Molecular Weight | 540.93 g/mol |
| Exact Mass | 540.37 |
| IUPAC Name | (2S)-6-hydroxy-6-methyl-2-[(2S,3R,4R)-4-methyl-3-triethylsilyloxyhex-5-en-2-yl]-5-[tri(propan-2-yl)silyloxymethyl]pyran-3-one |
| SMILES | C=C[C@@H](C)[C@@H](O[Si](CC)(CC)CC)[C@@H](C)[C@@H]1OC(C)(O)C(CO[Si](C(C)C)(C(C)C)C(C)C)=CC1=O |
| InChI | InChI=1S/C29H56O5Si2/c1-14-23(11)27(34-35(15-2,16-3)17-4)24(12)28-26(30)18-25(29(13,31)33-28)19-32-36(20(5)6,21(7)8)22(9)10/h14,18,20-24,27-28,31H,1,15-17,19H2,2-13H3/t23-,24-,27-,28+,29?/m1/s1 |
| InChIKey | ZVTYUBNHIPGCOA-SFXLYXAYSA-N |
| XLogP | 7.63 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.93 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|