C19H36O4Si — CID 162417299
6-hydroxy-6-methyl-2-propan-2-yl-5-[tri(propan-2-yl)silyloxymethyl]pyran-3-one (PubChem CID 162417299) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is 6-hydroxy-6-methyl-2-propan-2-yl-5-[tri(propan-2-yl)silyloxymethyl]pyran-3-one.
| Compound Name | 6-hydroxy-6-methyl-2-propan-2-yl-5-[tri(propan-2-yl)silyloxymethyl]pyran-3-one |
|---|---|
| PubChem CID | 162417299 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 6-hydroxy-6-methyl-2-propan-2-yl-5-[tri(propan-2-yl)silyloxymethyl]pyran-3-one |
| SMILES | CC(C)C1OC(C)(O)C(CO[Si](C(C)C)(C(C)C)C(C)C)=CC1=O |
| InChI | InChI=1S/C19H36O4Si/c1-12(2)18-17(20)10-16(19(9,21)23-18)11-22-24(13(3)4,14(5)6)15(7)8/h10,12-15,18,21H,11H2,1-9H3 |
| InChIKey | FNQNEAVZOLKYDT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|