C16H30O4Si — CID 11186113
(2R)-2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-6-hydroxy-5,6-dimethylpyran-3-one (PubChem CID 11186113) has the molecular formula C16H30O4Si and a molecular weight of 314.50 g/mol. Its IUPAC name is (2R)-2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-6-hydroxy-5,6-dimethylpyran-3-one.
| Compound Name | (2R)-2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-6-hydroxy-5,6-dimethylpyran-3-one |
|---|---|
| PubChem CID | 11186113 |
| Molecular Formula | C16H30O4Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (2R)-2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-6-hydroxy-5,6-dimethylpyran-3-one |
| SMILES | CC1=CC(=O)[C@@H](C[C@H](C)O[Si](C)(C)C(C)(C)C)OC1(C)O |
| InChI | InChI=1S/C16H30O4Si/c1-11-9-13(17)14(19-16(11,6)18)10-12(2)20-21(7,8)15(3,4)5/h9,12,14,18H,10H2,1-8H3/t12-,14+,16?/m0/s1 |
| InChIKey | WMRNJDYHQBLZFD-XNVGXSDDSA-N |
| XLogP | 3.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|