C15H32O4Si — CID 54768208
[(4S,5R)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (PubChem CID 54768208) has the molecular formula C15H32O4Si and a molecular weight of 304.50 g/mol. Its IUPAC name is [(4S,5R)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4S,5R)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 54768208 |
| Molecular Formula | C15H32O4Si |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | [(4S,5R)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| SMILES | C[C@H](C[C@H]1OC(C)(C)O[C@H]1CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H32O4Si/c1-11(19-20(7,8)14(2,3)4)9-12-13(10-16)18-15(5,6)17-12/h11-13,16H,9-10H2,1-8H3/t11-,12-,13+/m1/s1 |
| InChIKey | NCIFRYNAIFQVPI-UPJWGTAASA-N |
| XLogP | 3.30 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|