C26H54O4Si2 — CID 53329191
[(2R,3S)-3-[(E,4R,5R,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethyloct-2-enyl]-3-methyloxiran-2-yl]methanol (PubChem CID 53329191) has the molecular formula C26H54O4Si2 and a molecular weight of 486.89 g/mol. Its IUPAC name is [(2R,3S)-3-[(E,4R,5R,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethyloct-2-enyl]-3-methyloxiran-2-yl]methanol.
| Compound Name | [(2R,3S)-3-[(E,4R,5R,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethyloct-2-enyl]-3-methyloxiran-2-yl]methanol |
|---|---|
| PubChem CID | 53329191 |
| Molecular Formula | C26H54O4Si2 |
| Molecular Weight | 486.89 g/mol |
| Exact Mass | 486.36 |
| IUPAC Name | [(2R,3S)-3-[(E,4R,5R,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethyloct-2-enyl]-3-methyloxiran-2-yl]methanol |
| SMILES | C/C(=C\[C@@H](C)[C@@H](C[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C[C@]1(C)O[C@@H]1CO |
| InChI | InChI=1S/C26H54O4Si2/c1-19(17-26(10)23(18-27)28-26)15-20(2)22(30-32(13,14)25(7,8)9)16-21(3)29-31(11,12)24(4,5)6/h15,20-23,27H,16-18H2,1-14H3/b19-15+/t20-,21-,22-,23-,26+/m1/s1 |
| InChIKey | UGJZDWKPDSZYOZ-IEIJSEQXSA-N |
| XLogP | 7.30 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.89 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|