C18H37BO3Si — CID 122404223
tert-butyl-dimethyl-[(Z,2R)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-4-en-2-yl]oxysilane (PubChem CID 122404223) has the molecular formula C18H37BO3Si and a molecular weight of 340.39 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z,2R)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-4-en-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(Z,2R)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-4-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 122404223 |
| Molecular Formula | C18H37BO3Si |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | tert-butyl-dimethyl-[(Z,2R)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-4-en-2-yl]oxysilane |
| SMILES | C/C(=C\C[C@@H](C)O[Si](C)(C)C(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H37BO3Si/c1-14(19-21-17(6,7)18(8,9)22-19)12-13-15(2)20-23(10,11)16(3,4)5/h12,15H,13H2,1-11H3/b14-12+/t15-/m1/s1 |
| InChIKey | PXSPBBYHDUDUCZ-OKFGHLOFSA-N |
| XLogP | 5.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|