C21H43BO3Si — CID 154719608
tert-butyl-[(E,2S,3R)-2,5-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-4-enoxy]-dimethylsilane (PubChem CID 154719608) has the molecular formula C21H43BO3Si and a molecular weight of 382.47 g/mol. Its IUPAC name is tert-butyl-[(E,2S,3R)-2,5-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,2S,3R)-2,5-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 154719608 |
| Molecular Formula | C21H43BO3Si |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | tert-butyl-[(E,2S,3R)-2,5-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-4-enoxy]-dimethylsilane |
| SMILES | CC/C(C)=C/[C@@H](B1OC(C)(C)C(C)(C)O1)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H43BO3Si/c1-13-16(2)14-18(22-24-20(7,8)21(9,10)25-22)17(3)15-23-26(11,12)19(4,5)6/h14,17-18H,13,15H2,1-12H3/b16-14+/t17-,18-/m1/s1 |
| InChIKey | PPRYAXFCZVILDS-JPHOHROUSA-N |
| XLogP | 6.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|