C19H39BO4Si — CID 138977970
(Z,2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-5-en-3-ol (PubChem CID 138977970) has the molecular formula C19H39BO4Si and a molecular weight of 370.42 g/mol. Its IUPAC name is (Z,2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-5-en-3-ol.
| Compound Name | (Z,2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-5-en-3-ol |
|---|---|
| PubChem CID | 138977970 |
| Molecular Formula | C19H39BO4Si |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | (Z,2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-5-en-3-ol |
| SMILES | C/C(=C\C[C@H](O)[C@@H](C)O[Si](C)(C)C(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H39BO4Si/c1-14(20-23-18(6,7)19(8,9)24-20)12-13-16(21)15(2)22-25(10,11)17(3,4)5/h12,15-16,21H,13H2,1-11H3/b14-12+/t15-,16+/m1/s1 |
| InChIKey | QQHOSQUBZZJLFW-VSFMZDRDSA-N |
| XLogP | 4.73 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|