C39H78O4Si3 — CID 138977537
(2R,3S,5E,7E,9R,10S,11E,13S)-2,13-bis[[tert-butyl(dimethyl)silyl]oxy]-10-ethyl-6,8,12-trimethyl-9-triethylsilyloxyhexadeca-5,7,11,15-tetraen-3-ol (PubChem CID 138977537) has the molecular formula C39H78O4Si3 and a molecular weight of 695.31 g/mol. Its IUPAC name is (2R,3S,5E,7E,9R,10S,11E,13S)-2,13-bis[[tert-butyl(dimethyl)silyl]oxy]-10-ethyl-6,8,12-trimethyl-9-triethylsilyloxyhexadeca-5,7,11,15-tetraen-3-ol.
| Compound Name | (2R,3S,5E,7E,9R,10S,11E,13S)-2,13-bis[[tert-butyl(dimethyl)silyl]oxy]-10-ethyl-6,8,12-trimethyl-9-triethylsilyloxyhexadeca-5,7,11,15-tetraen-3-ol |
|---|---|
| PubChem CID | 138977537 |
| Molecular Formula | C39H78O4Si3 |
| Molecular Weight | 695.31 g/mol |
| Exact Mass | 694.52 |
| IUPAC Name | (2R,3S,5E,7E,9R,10S,11E,13S)-2,13-bis[[tert-butyl(dimethyl)silyl]oxy]-10-ethyl-6,8,12-trimethyl-9-triethylsilyloxyhexadeca-5,7,11,15-tetraen-3-ol |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@H](CC)[C@@H](O[Si](CC)(CC)CC)/C(C)=C/C(C)=C/C[C@H](O)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H78O4Si3/c1-20-25-36(42-45(18,19)39(13,14)15)31(7)29-34(21-2)37(43-46(22-3,23-4)24-5)32(8)28-30(6)26-27-35(40)33(9)41-44(16,17)38(10,11)12/h20,26,28-29,33-37,40H,1,21-25,27H2,2-19H3/b30-26+,31-29+,32-28+/t33-,34+,35+,36+,37+/m1/s1 |
| InChIKey | WLMXEFZRGNWGMK-JBJYTUEHSA-N |
| XLogP | 12.37 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.31 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|