C24H40O4Si — CID 10047782
tert-butyl (2Z,4E,8E)-6-[(2-methylpropan-2-yl)oxy]-7-oxo-5-prop-2-enyl-4-trimethylsilyldeca-2,4,8-trienoate (PubChem CID 10047782) has the molecular formula C24H40O4Si and a molecular weight of 420.67 g/mol. Its IUPAC name is tert-butyl (2Z,4E,8E)-6-[(2-methylpropan-2-yl)oxy]-7-oxo-5-prop-2-enyl-4-trimethylsilyldeca-2,4,8-trienoate.
| Compound Name | tert-butyl (2Z,4E,8E)-6-[(2-methylpropan-2-yl)oxy]-7-oxo-5-prop-2-enyl-4-trimethylsilyldeca-2,4,8-trienoate |
|---|---|
| PubChem CID | 10047782 |
| Molecular Formula | C24H40O4Si |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | tert-butyl (2Z,4E,8E)-6-[(2-methylpropan-2-yl)oxy]-7-oxo-5-prop-2-enyl-4-trimethylsilyldeca-2,4,8-trienoate |
| SMILES | C=CC/C(=C(/C=C\C(=O)OC(C)(C)C)[Si](C)(C)C)C(OC(C)(C)C)C(=O)/C=C/C |
| InChI | InChI=1S/C24H40O4Si/c1-12-14-18(22(19(25)15-13-2)28-24(6,7)8)20(29(9,10)11)16-17-21(26)27-23(3,4)5/h12-13,15-17,22H,1,14H2,2-11H3/b15-13+,17-16-,20-18+ |
| InChIKey | QZSMFMICWCZJHF-NJXSSSTFSA-N |
| XLogP | 5.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|