About dimethyl (Z)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-1-enyl]but-2-enedioate
dimethyl (Z)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-1-enyl]but-2-enedioate (PubChem CID 58409710) has the molecular formula C18H32O5Si
and a molecular weight of 356.54 g/mol. Its IUPAC name is dimethyl (Z)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-1-enyl]but-2-enedioate.
Molecular Properties
| Compound Name | dimethyl (Z)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-1-enyl]but-2-enedioate |
| PubChem CID | 58409710 |
| Molecular Formula | C18H32O5Si |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | dimethyl (Z)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-1-enyl]but-2-enedioate |
| SMILES | CCC[C@@H](/C=C/C(=C/C(=O)OC)C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32O5Si/c1-9-10-15(23-24(7,8)18(2,3)4)12-11-14(17(20)22-6)13-16(19)21-5/h11-13,15H,9-10H2,1-8H3/b12-11+,14-13-/t15-/m0/s1 |
| InChIKey | PJTXZPPBQYSIMG-CCNXAXJRSA-N |
| XLogP | 4.01 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (Z)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-1-enyl]but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (Z)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-1-enyl]but-2-enedioate?
The IUPAC name of dimethyl (Z)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-1-enyl]but-2-enedioate (CID 58409710) is dimethyl (Z)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-1-enyl]but-2-enedioate.
What is the SMILES notation for dimethyl (Z)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-1-enyl]but-2-enedioate?
The canonical SMILES for dimethyl (Z)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-1-enyl]but-2-enedioate is CCC[C@@H](/C=C/C(=C/C(=O)OC)C(=O)OC)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of dimethyl (Z)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-1-enyl]but-2-enedioate?
The InChIKey is PJTXZPPBQYSIMG-CCNXAXJRSA-N. The full InChI is InChI=1S/C18H32O5Si/c1-9-10-15(23-24(7,8)18(2,3)4)12-11-14(17(20)22-6)13-16(19)21-5/h11-13,15H,9-10H2,1-8H3/b12-11+,14-13-/t15-/m0/s1.
What are the key properties of dimethyl (Z)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-1-enyl]but-2-enedioate?
dimethyl (Z)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-1-enyl]but-2-enedioate has a molecular weight of 356.54 g/mol, XLogP of 4.01, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (Z)-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-1-enyl]but-2-enedioate is sourced from PubChem (CID 58409710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).