C18H30O4Si — CID 11186803
ethyl (2Z,4E,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-10-oxodeca-2,4,8-trienoate (PubChem CID 11186803) has the molecular formula C18H30O4Si and a molecular weight of 338.52 g/mol. Its IUPAC name is ethyl (2Z,4E,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-10-oxodeca-2,4,8-trienoate.
| Compound Name | ethyl (2Z,4E,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-10-oxodeca-2,4,8-trienoate |
|---|---|
| PubChem CID | 11186803 |
| Molecular Formula | C18H30O4Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | ethyl (2Z,4E,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-10-oxodeca-2,4,8-trienoate |
| SMILES | CCOC(=O)/C=C\C=C\C[C@@H](/C=C/C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H30O4Si/c1-7-21-17(20)14-10-8-9-12-16(13-11-15-19)22-23(5,6)18(2,3)4/h8-11,13-16H,7,12H2,1-6H3/b9-8+,13-11+,14-10-/t16-/m0/s1 |
| InChIKey | JWCMEJPAOQMOAX-IMSLDAJHSA-N |
| XLogP | 4.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|