C13H26O3Si — CID 10901315
ethyl (E,4R)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoate (PubChem CID 10901315) has the molecular formula C13H26O3Si and a molecular weight of 258.43 g/mol. Its IUPAC name is ethyl (E,4R)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoate.
| Compound Name | ethyl (E,4R)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoate |
|---|---|
| PubChem CID | 10901315 |
| Molecular Formula | C13H26O3Si |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | ethyl (E,4R)-4-[tert-butyl(dimethyl)silyl]oxypent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H26O3Si/c1-8-15-12(14)10-9-11(2)16-17(6,7)13(3,4)5/h9-11H,8H2,1-7H3/b10-9+/t11-/m1/s1 |
| InChIKey | JIPMHCMBHMJNGC-PBQZMEPESA-N |
| XLogP | 3.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|