C15H28O3Si — CID 11140643
(2E,4E,6R)-8-[tert-butyl(dimethyl)silyl]oxy-6-methoxyocta-2,4-dienal (PubChem CID 11140643) has the molecular formula C15H28O3Si and a molecular weight of 284.47 g/mol. Its IUPAC name is (2E,4E,6R)-8-[tert-butyl(dimethyl)silyl]oxy-6-methoxyocta-2,4-dienal.
| Compound Name | (2E,4E,6R)-8-[tert-butyl(dimethyl)silyl]oxy-6-methoxyocta-2,4-dienal |
|---|---|
| PubChem CID | 11140643 |
| Molecular Formula | C15H28O3Si |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (2E,4E,6R)-8-[tert-butyl(dimethyl)silyl]oxy-6-methoxyocta-2,4-dienal |
| SMILES | CO[C@@H](/C=C/C=C/C=O)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H28O3Si/c1-15(2,3)19(5,6)18-13-11-14(17-4)10-8-7-9-12-16/h7-10,12,14H,11,13H2,1-6H3/b9-7+,10-8+/t14-/m0/s1 |
| InChIKey | QKYHABUANGLRIJ-NKYSGAOISA-N |
| XLogP | 3.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|