C17H30O2Si — CID 10469740
(2E,6E)-5-[(2-methylpropan-2-yl)oxy]-6-(trimethylsilylmethylidene)nona-2,8-dien-4-one (PubChem CID 10469740) has the molecular formula C17H30O2Si and a molecular weight of 294.51 g/mol. Its IUPAC name is (2E,6E)-5-[(2-methylpropan-2-yl)oxy]-6-(trimethylsilylmethylidene)nona-2,8-dien-4-one.
| Compound Name | (2E,6E)-5-[(2-methylpropan-2-yl)oxy]-6-(trimethylsilylmethylidene)nona-2,8-dien-4-one |
|---|---|
| PubChem CID | 10469740 |
| Molecular Formula | C17H30O2Si |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | (2E,6E)-5-[(2-methylpropan-2-yl)oxy]-6-(trimethylsilylmethylidene)nona-2,8-dien-4-one |
| SMILES | C=CC/C(=C\[Si](C)(C)C)C(OC(C)(C)C)C(=O)/C=C/C |
| InChI | InChI=1S/C17H30O2Si/c1-9-11-14(13-20(6,7)8)16(15(18)12-10-2)19-17(3,4)5/h9-10,12-13,16H,1,11H2,2-8H3/b12-10+,14-13+ |
| InChIKey | SVDDQXNBZSBLQG-HBKPYOMSSA-N |
| XLogP | 4.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|