C21H38O2Si — CID 134919359
(4R,5S)-5-ethoxy-3,4-dimethyl-5-[(E)-prop-1-enyl]-2-tri(propan-2-yl)silylcyclopent-2-en-1-one (PubChem CID 134919359) has the molecular formula C21H38O2Si and a molecular weight of 350.62 g/mol. Its IUPAC name is (4R,5S)-5-ethoxy-3,4-dimethyl-5-[(E)-prop-1-enyl]-2-tri(propan-2-yl)silylcyclopent-2-en-1-one.
| Compound Name | (4R,5S)-5-ethoxy-3,4-dimethyl-5-[(E)-prop-1-enyl]-2-tri(propan-2-yl)silylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 134919359 |
| Molecular Formula | C21H38O2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | (4R,5S)-5-ethoxy-3,4-dimethyl-5-[(E)-prop-1-enyl]-2-tri(propan-2-yl)silylcyclopent-2-en-1-one |
| SMILES | C/C=C/[C@@]1(OCC)C(=O)C([Si](C(C)C)(C(C)C)C(C)C)=C(C)[C@H]1C |
| InChI | InChI=1S/C21H38O2Si/c1-11-13-21(23-12-2)18(10)17(9)19(20(21)22)24(14(3)4,15(5)6)16(7)8/h11,13-16,18H,12H2,1-10H3/b13-11+/t18-,21+/m1/s1 |
| InChIKey | MNWMFIJEHSTOKA-MEEOWFORSA-N |
| XLogP | 6.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|