C17H26O3Si — CID 102283013
2-methyl-5-[(E)-7-trimethylsilylhept-6-en-3-yl]oxycyclohexa-2,5-diene-1,4-dione (PubChem CID 102283013) has the molecular formula C17H26O3Si and a molecular weight of 306.48 g/mol. Its IUPAC name is 2-methyl-5-[(E)-7-trimethylsilylhept-6-en-3-yl]oxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-methyl-5-[(E)-7-trimethylsilylhept-6-en-3-yl]oxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 102283013 |
| Molecular Formula | C17H26O3Si |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-methyl-5-[(E)-7-trimethylsilylhept-6-en-3-yl]oxycyclohexa-2,5-diene-1,4-dione |
| SMILES | CCC(CC/C=C/[Si](C)(C)C)OC1=CC(=O)C(C)=CC1=O |
| InChI | InChI=1S/C17H26O3Si/c1-6-14(9-7-8-10-21(3,4)5)20-17-12-15(18)13(2)11-16(17)19/h8,10-12,14H,6-7,9H2,1-5H3/b10-8+ |
| InChIKey | ACEPKNSMTJJXJG-CSKARUKUSA-N |
| XLogP | 3.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|