C20H30O5Si — CID 102306550
[(Z)-2-methyl-2-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)oxy-7-trimethylsilylhept-5-en-3-yl] acetate (PubChem CID 102306550) has the molecular formula C20H30O5Si and a molecular weight of 378.54 g/mol. Its IUPAC name is [(Z)-2-methyl-2-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)oxy-7-trimethylsilylhept-5-en-3-yl] acetate.
| Compound Name | [(Z)-2-methyl-2-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)oxy-7-trimethylsilylhept-5-en-3-yl] acetate |
|---|---|
| PubChem CID | 102306550 |
| Molecular Formula | C20H30O5Si |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | [(Z)-2-methyl-2-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)oxy-7-trimethylsilylhept-5-en-3-yl] acetate |
| SMILES | CC(=O)OC(C/C=C\C[Si](C)(C)C)C(C)(C)OC1=CC(=O)C(C)=CC1=O |
| InChI | InChI=1S/C20H30O5Si/c1-14-12-17(23)18(13-16(14)22)25-20(3,4)19(24-15(2)21)10-8-9-11-26(5,6)7/h8-9,12-13,19H,10-11H2,1-7H3/b9-8- |
| InChIKey | QUSMCORDUMNXIO-HJWRWDBZSA-N |
| XLogP | 3.98 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|