C18H26O5Si — CID 71486382
[(Z)-1-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)oxy-6-trimethylsilylhex-4-en-2-yl] acetate (PubChem CID 71486382) has the molecular formula C18H26O5Si and a molecular weight of 350.49 g/mol. Its IUPAC name is [(Z)-1-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)oxy-6-trimethylsilylhex-4-en-2-yl] acetate.
| Compound Name | [(Z)-1-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)oxy-6-trimethylsilylhex-4-en-2-yl] acetate |
|---|---|
| PubChem CID | 71486382 |
| Molecular Formula | C18H26O5Si |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | [(Z)-1-(4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)oxy-6-trimethylsilylhex-4-en-2-yl] acetate |
| SMILES | CC(=O)OC(C/C=C\C[Si](C)(C)C)COC1=CC(=O)C(C)=CC1=O |
| InChI | InChI=1S/C18H26O5Si/c1-13-10-17(21)18(11-16(13)20)22-12-15(23-14(2)19)8-6-7-9-24(3,4)5/h6-7,10-11,15H,8-9,12H2,1-5H3/b7-6- |
| InChIKey | OVMPQMZNADNPKG-SREVYHEPSA-N |
| XLogP | 3.20 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|