C15H22O3Si — CID 71486533
2-methyl-5-[(E)-5-trimethylsilylpent-3-enoxy]cyclohexa-2,5-diene-1,4-dione (PubChem CID 71486533) has the molecular formula C15H22O3Si and a molecular weight of 278.42 g/mol. Its IUPAC name is 2-methyl-5-[(E)-5-trimethylsilylpent-3-enoxy]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-methyl-5-[(E)-5-trimethylsilylpent-3-enoxy]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 71486533 |
| Molecular Formula | C15H22O3Si |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-methyl-5-[(E)-5-trimethylsilylpent-3-enoxy]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CC(=O)C(OCC/C=C/C[Si](C)(C)C)=CC1=O |
| InChI | InChI=1S/C15H22O3Si/c1-12-10-14(17)15(11-13(12)16)18-8-6-5-7-9-19(2,3)4/h5,7,10-11H,6,8-9H2,1-4H3/b7-5+ |
| InChIKey | ZKTLSMGMQAGURP-FNORWQNLSA-N |
| XLogP | 3.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|