C12H18O4Si — CID 14689914
2,3-dimethoxy-5-(trimethylsilylmethyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 14689914) has the molecular formula C12H18O4Si and a molecular weight of 254.36 g/mol. Its IUPAC name is 2,3-dimethoxy-5-(trimethylsilylmethyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3-dimethoxy-5-(trimethylsilylmethyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 14689914 |
| Molecular Formula | C12H18O4Si |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 2,3-dimethoxy-5-(trimethylsilylmethyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(C[Si](C)(C)C)=CC1=O |
| InChI | InChI=1S/C12H18O4Si/c1-15-11-9(13)6-8(7-17(3,4)5)10(14)12(11)16-2/h6H,7H2,1-5H3 |
| InChIKey | GYKJQMRMROAMAW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|